C7H9BO3 — CID 162422450
(2,3,5,6-tetradeuterio-4-methoxyphenyl)boronic acid (PubChem CID 162422450) has the molecular formula C7H9BO3 and a molecular weight of 155.98 g/mol. Its IUPAC name is (2,3,5,6-tetradeuterio-4-methoxyphenyl)boronic acid.
| Compound Name | (2,3,5,6-tetradeuterio-4-methoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 162422450 |
| Molecular Formula | C7H9BO3 |
| Molecular Weight | 155.98 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (2,3,5,6-tetradeuterio-4-methoxyphenyl)boronic acid |
| SMILES | [2H]c1c([2H])c(B(O)O)c([2H])c([2H])c1OC |
| InChI | InChI=1S/C7H9BO3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5,9-10H,1H3/i2D,3D,4D,5D |
| InChIKey | VOAAEKKFGLPLLU-QFFDRWTDSA-N |
| XLogP | -0.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.98 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|