C14H14N4 — CID 102627155
N-[2-(aminomethyl)phenyl]imidazo[1,2-a]pyridin-5-amine (PubChem CID 102627155) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-[2-(aminomethyl)phenyl]imidazo[1,2-a]pyridin-5-amine.
| Compound Name | N-[2-(aminomethyl)phenyl]imidazo[1,2-a]pyridin-5-amine |
|---|---|
| PubChem CID | 102627155 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-[2-(aminomethyl)phenyl]imidazo[1,2-a]pyridin-5-amine |
| SMILES | NCc1ccccc1Nc1cccc2nccn12 |
| InChI | InChI=1S/C14H14N4/c15-10-11-4-1-2-5-12(11)17-14-7-3-6-13-16-8-9-18(13)14/h1-9,17H,10,15H2 |
| InChIKey | YZMWJEBIZUBOGM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |