C12H20N2O — CID 102654326
[2-(cyclohexen-1-yl)-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine (PubChem CID 102654326) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is [2-(cyclohexen-1-yl)-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine.
| Compound Name | [2-(cyclohexen-1-yl)-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102654326 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [2-(cyclohexen-1-yl)-1-(2,3-dihydrofuran-5-yl)ethyl]hydrazine |
| SMILES | NNC(CC1=CCCCC1)C1=CCCO1 |
| InChI | InChI=1S/C12H20N2O/c13-14-11(12-7-4-8-15-12)9-10-5-2-1-3-6-10/h5,7,11,14H,1-4,6,8-9,13H2 |
| InChIKey | WSZYDVBAICFTIK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|