C16H18N2O2S — CID 10266917
2-(6,7-dimethoxy-3,4-dihydro-2H-1,3-benzothiazin-4-yl)aniline (PubChem CID 10266917) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(6,7-dimethoxy-3,4-dihydro-2H-1,3-benzothiazin-4-yl)aniline.
| Compound Name | 2-(6,7-dimethoxy-3,4-dihydro-2H-1,3-benzothiazin-4-yl)aniline |
|---|---|
| PubChem CID | 10266917 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(6,7-dimethoxy-3,4-dihydro-2H-1,3-benzothiazin-4-yl)aniline |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1N)NCS2 |
| InChI | InChI=1S/C16H18N2O2S/c1-19-13-7-11-15(8-14(13)20-2)21-9-18-16(11)10-5-3-4-6-12(10)17/h3-8,16,18H,9,17H2,1-2H3 |
| InChIKey | CFRCQQOYQSJGSS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|