C19H22ClNO3 — CID 139798872
2-chloro-4-(3,4-dimethoxyphenyl)-3-(2-methoxyphenyl)pyrrolidine (PubChem CID 139798872) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 2-chloro-4-(3,4-dimethoxyphenyl)-3-(2-methoxyphenyl)pyrrolidine.
| Compound Name | 2-chloro-4-(3,4-dimethoxyphenyl)-3-(2-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 139798872 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-chloro-4-(3,4-dimethoxyphenyl)-3-(2-methoxyphenyl)pyrrolidine |
| SMILES | COc1ccc(C2CNC(Cl)C2c2ccccc2OC)cc1OC |
| InChI | InChI=1S/C19H22ClNO3/c1-22-15-7-5-4-6-13(15)18-14(11-21-19(18)20)12-8-9-16(23-2)17(10-12)24-3/h4-10,14,18-19,21H,11H2,1-3H3 |
| InChIKey | LONPYUDJJLWPMF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|