C12H24N2O5S — CID 102685098
ethyl 3,3-dimethyl-2-[2-(methylsulfamoyl)ethylcarbamoyl]butanoate (PubChem CID 102685098) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-[2-(methylsulfamoyl)ethylcarbamoyl]butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-[2-(methylsulfamoyl)ethylcarbamoyl]butanoate |
|---|---|
| PubChem CID | 102685098 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 3,3-dimethyl-2-[2-(methylsulfamoyl)ethylcarbamoyl]butanoate |
| SMILES | CCOC(=O)C(C(=O)NCCS(=O)(=O)NC)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O5S/c1-6-19-11(16)9(12(2,3)4)10(15)14-7-8-20(17,18)13-5/h9,13H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | OKLFUPMWPSPSJK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|