C13H26N2O5S — CID 106341880
ethyl 2-[2-(dimethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate (PubChem CID 106341880) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 2-[2-(dimethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[2-(dimethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 106341880 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 2-[2-(dimethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NCCS(=O)(=O)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O5S/c1-7-20-12(17)10(13(2,3)4)11(16)14-8-9-21(18,19)15(5)6/h10H,7-9H2,1-6H3,(H,14,16) |
| InChIKey | NFGCDQWTVFCYGT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|