C13H26N2O5S — CID 104919615
ethyl 2-[2-(ethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate (PubChem CID 104919615) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is ethyl 2-[2-(ethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[2-(ethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 104919615 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl 2-[2-(ethylsulfamoyl)ethylcarbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCNS(=O)(=O)CCNC(=O)C(C(=O)OCC)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O5S/c1-6-15-21(18,19)9-8-14-11(16)10(13(3,4)5)12(17)20-7-2/h10,15H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | QRCZSAZVULNNQE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|