C16H14Cl2N4S — CID 10270181
N,3-bis[(6-chloro-3-pyridinyl)methyl]-4-methyl-1,3-thiazol-2-imine (PubChem CID 10270181) has the molecular formula C16H14Cl2N4S and a molecular weight of 365.29 g/mol. Its IUPAC name is N,3-bis[(6-chloro-3-pyridinyl)methyl]-4-methyl-1,3-thiazol-2-imine.
| Compound Name | N,3-bis[(6-chloro-3-pyridinyl)methyl]-4-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 10270181 |
| Molecular Formula | C16H14Cl2N4S |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | N,3-bis[(6-chloro-3-pyridinyl)methyl]-4-methyl-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\Cc2ccc(Cl)nc2)n1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H14Cl2N4S/c1-11-10-23-16(21-7-12-2-4-14(17)19-6-12)22(11)9-13-3-5-15(18)20-8-13/h2-6,8,10H,7,9H2,1H3/b21-16- |
| InChIKey | JNPDQGITGKKKGZ-PGMHBOJBSA-N |
| XLogP | 4.10 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|