C23H20N2O3 — CID 10270611
(4-benzoylphenyl) N-(3,4-dihydro-1H-isoquinolin-2-yl)carbamate (PubChem CID 10270611) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is (4-benzoylphenyl) N-(3,4-dihydro-1H-isoquinolin-2-yl)carbamate.
| Compound Name | (4-benzoylphenyl) N-(3,4-dihydro-1H-isoquinolin-2-yl)carbamate |
|---|---|
| PubChem CID | 10270611 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (4-benzoylphenyl) N-(3,4-dihydro-1H-isoquinolin-2-yl)carbamate |
| SMILES | O=C(NN1CCc2ccccc2C1)Oc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O3/c26-22(18-7-2-1-3-8-18)19-10-12-21(13-11-19)28-23(27)24-25-15-14-17-6-4-5-9-20(17)16-25/h1-13H,14-16H2,(H,24,27) |
| InChIKey | HUAIQRGCPXVBHD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |