C11H14F3N3O2S2 — CID 102718841
6-(3-methylsulfonylthiomorpholin-4-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102718841) has the molecular formula C11H14F3N3O2S2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 6-(3-methylsulfonylthiomorpholin-4-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(3-methylsulfonylthiomorpholin-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102718841 |
| Molecular Formula | C11H14F3N3O2S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 6-(3-methylsulfonylthiomorpholin-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CS(=O)(=O)C1CSCCN1c1cc(C(F)(F)F)cc(N)n1 |
| InChI | InChI=1S/C11H14F3N3O2S2/c1-21(18,19)10-6-20-3-2-17(10)9-5-7(11(12,13)14)4-8(15)16-9/h4-5,10H,2-3,6H2,1H3,(H2,15,16) |
| InChIKey | ZQFGTMSNXXTOQE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |