C18H17BrN2O2S — CID 10272608
7-(7-bromoindol-1-yl)sulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 10272608) has the molecular formula C18H17BrN2O2S and a molecular weight of 405.32 g/mol. Its IUPAC name is 7-(7-bromoindol-1-yl)sulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 7-(7-bromoindol-1-yl)sulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 10272608 |
| Molecular Formula | C18H17BrN2O2S |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 7-(7-bromoindol-1-yl)sulfonyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | O=S(=O)(c1ccc2c(c1)CCNCC2)n1ccc2cccc(Br)c21 |
| InChI | InChI=1S/C18H17BrN2O2S/c19-17-3-1-2-14-8-11-21(18(14)17)24(22,23)16-5-4-13-6-9-20-10-7-15(13)12-16/h1-5,8,11-12,20H,6-7,9-10H2 |
| InChIKey | LUEMKKOXASUCTB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |