C15H22N2 — CID 102738931
trans-(1R,2R)-2-(3-phenylazetidin-1-yl)cyclohexan-1-amine (PubChem CID 102738931) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-phenylazetidin-1-yl)cyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-(3-phenylazetidin-1-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 102738931 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | trans-(1R,2R)-2-(3-phenylazetidin-1-yl)cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@H]1N1CC(c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2/c16-14-8-4-5-9-15(14)17-10-13(11-17)12-6-2-1-3-7-12/h1-3,6-7,13-15H,4-5,8-11,16H2/t14-,15-/m1/s1 |
| InChIKey | CYZGXLVYGLCERG-HUUCEWRRSA-N |
| XLogP | 2.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |