C13H15NO5S2 — CID 102748041
methyl 3-[1-(furan-2-yl)ethylsulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 102748041) has the molecular formula C13H15NO5S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 3-[1-(furan-2-yl)ethylsulfamoyl]-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-[1-(furan-2-yl)ethylsulfamoyl]-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102748041 |
| Molecular Formula | C13H15NO5S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | methyl 3-[1-(furan-2-yl)ethylsulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NC(C)c1ccco1 |
| InChI | InChI=1S/C13H15NO5S2/c1-8-7-20-11(13(15)18-3)12(8)21(16,17)14-9(2)10-5-4-6-19-10/h4-7,9,14H,1-3H3 |
| InChIKey | DMRLJZWRAVXGFD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |