C12H12BrN5 — CID 102822321
3-bromo-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile (PubChem CID 102822321) has the molecular formula C12H12BrN5 and a molecular weight of 306.17 g/mol. Its IUPAC name is 3-bromo-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile.
| Compound Name | 3-bromo-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile |
|---|---|
| PubChem CID | 102822321 |
| Molecular Formula | C12H12BrN5 |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 3-bromo-5-[3-(1H-1,2,4-triazol-5-yl)propylamino]benzonitrile |
| SMILES | N#Cc1cc(Br)cc(NCCCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C12H12BrN5/c13-10-4-9(7-14)5-11(6-10)15-3-1-2-12-16-8-17-18-12/h4-6,8,15H,1-3H2,(H,16,17,18) |
| InChIKey | JJVQXNMYQORWEF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|