C12H18BrNOS — CID 102835096
N-[(4-bromo-5-methylthiophen-2-yl)methyl]-1-(oxan-2-yl)methanamine (PubChem CID 102835096) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]-1-(oxan-2-yl)methanamine.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-1-(oxan-2-yl)methanamine |
|---|---|
| PubChem CID | 102835096 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-1-(oxan-2-yl)methanamine |
| SMILES | Cc1sc(CNCC2CCCCO2)cc1Br |
| InChI | InChI=1S/C12H18BrNOS/c1-9-12(13)6-11(16-9)8-14-7-10-4-2-3-5-15-10/h6,10,14H,2-5,7-8H2,1H3 |
| InChIKey | HAZIBTGZDRSKLH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |