C32H32ClF3N2O — CID 10289688
3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-methylaniline (PubChem CID 10289688) has the molecular formula C32H32ClF3N2O and a molecular weight of 553.07 g/mol. Its IUPAC name is 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-methylaniline.
| Compound Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-methylaniline |
|---|---|
| PubChem CID | 10289688 |
| Molecular Formula | C32H32ClF3N2O |
| Molecular Weight | 553.07 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-N-methylaniline |
| SMILES | CNc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C32H32ClF3N2O/c1-37-27-16-9-17-28(21-27)39-20-10-19-38(22-26-15-8-18-30(31(26)33)32(34,35)36)23-29(24-11-4-2-5-12-24)25-13-6-3-7-14-25/h2-9,11-18,21,29,37H,10,19-20,22-23H2,1H3 |
| InChIKey | UZQBIENHMBVPOV-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.07 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|