C8H20N2O2S — CID 102908416
2,4-dimethyl-3-[(sulfamoylamino)methyl]pentane (PubChem CID 102908416) has the molecular formula C8H20N2O2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2,4-dimethyl-3-[(sulfamoylamino)methyl]pentane.
| Compound Name | 2,4-dimethyl-3-[(sulfamoylamino)methyl]pentane |
|---|---|
| PubChem CID | 102908416 |
| Molecular Formula | C8H20N2O2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2,4-dimethyl-3-[(sulfamoylamino)methyl]pentane |
| SMILES | CC(C)C(CNS(N)(=O)=O)C(C)C |
| InChI | InChI=1S/C8H20N2O2S/c1-6(2)8(7(3)4)5-10-13(9,11)12/h6-8,10H,5H2,1-4H3,(H2,9,11,12) |
| InChIKey | SJYZWIDJIQXDIW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |