C10H21N5 — CID 102913752
1-methyl-N-(3-methyl-2-propan-2-ylbutyl)tetrazol-5-amine (PubChem CID 102913752) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-methyl-N-(3-methyl-2-propan-2-ylbutyl)tetrazol-5-amine.
| Compound Name | 1-methyl-N-(3-methyl-2-propan-2-ylbutyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 102913752 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | 1-methyl-N-(3-methyl-2-propan-2-ylbutyl)tetrazol-5-amine |
| SMILES | CC(C)C(CNc1nnnn1C)C(C)C |
| InChI | InChI=1S/C10H21N5/c1-7(2)9(8(3)4)6-11-10-12-13-14-15(10)5/h7-9H,6H2,1-5H3,(H,11,12,14) |
| InChIKey | LLIWKLJRHBQVBT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |