C8H16ClN5 — CID 107156271
N-(2-chloro-4-methylpentyl)-1-methyltetrazol-5-amine (PubChem CID 107156271) has the molecular formula C8H16ClN5 and a molecular weight of 217.70 g/mol. Its IUPAC name is N-(2-chloro-4-methylpentyl)-1-methyltetrazol-5-amine.
| Compound Name | N-(2-chloro-4-methylpentyl)-1-methyltetrazol-5-amine |
|---|---|
| PubChem CID | 107156271 |
| Molecular Formula | C8H16ClN5 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(2-chloro-4-methylpentyl)-1-methyltetrazol-5-amine |
| SMILES | CC(C)CC(Cl)CNc1nnnn1C |
| InChI | InChI=1S/C8H16ClN5/c1-6(2)4-7(9)5-10-8-11-12-13-14(8)3/h6-7H,4-5H2,1-3H3,(H,10,11,13) |
| InChIKey | VKJJTZMQDSLTLY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|