C10H17N3O3 — CID 102929357
5-(aminomethyl)-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 102929357) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 5-(aminomethyl)-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-(aminomethyl)-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 102929357 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 5-(aminomethyl)-2-[2-(2-methoxyethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | COCCOCCc1ncc(CN)c(=O)[nH]1 |
| InChI | InChI=1S/C10H17N3O3/c1-15-4-5-16-3-2-9-12-7-8(6-11)10(14)13-9/h7H,2-6,11H2,1H3,(H,12,13,14) |
| InChIKey | INILRNAUJSRQSN-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|