C8H10N6 — CID 102983865
3-N-(1H-pyrazol-4-ylmethyl)pyrazine-2,3-diamine (PubChem CID 102983865) has the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. Its IUPAC name is 3-N-(1H-pyrazol-4-ylmethyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(1H-pyrazol-4-ylmethyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 102983865 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-N-(1H-pyrazol-4-ylmethyl)pyrazine-2,3-diamine |
| SMILES | Nc1nccnc1NCc1cn[nH]c1 |
| InChI | InChI=1S/C8H10N6/c9-7-8(11-2-1-10-7)12-3-6-4-13-14-5-6/h1-2,4-5H,3H2,(H2,9,10)(H,11,12)(H,13,14) |
| InChIKey | PJLCCHVDASPBGX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |