C24H35Cl2N3O2S — CID 10300612
2-[2-[4-[(2R)-2-methyl-3-phenothiazin-10-ylpropyl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride (PubChem CID 10300612) has the molecular formula C24H35Cl2N3O2S and a molecular weight of 500.54 g/mol. Its IUPAC name is 2-[2-[4-[(2R)-2-methyl-3-phenothiazin-10-ylpropyl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride.
| Compound Name | 2-[2-[4-[(2R)-2-methyl-3-phenothiazin-10-ylpropyl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 10300612 |
| Molecular Formula | C24H35Cl2N3O2S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[2-[4-[(2R)-2-methyl-3-phenothiazin-10-ylpropyl]piperazin-1-yl]ethoxy]ethanol;dihydrochloride |
| SMILES | C[C@H](CN1CCN(CCOCCO)CC1)CN1c2ccccc2Sc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C24H33N3O2S.2ClH/c1-20(18-26-12-10-25(11-13-26)14-16-29-17-15-28)19-27-21-6-2-4-8-23(21)30-24-9-5-3-7-22(24)27;;/h2-9,20,28H,10-19H2,1H3;2*1H/t20-;;/m1../s1 |
| InChIKey | PZYZOXQAAJBNOK-FAVHNTAZSA-N |
| XLogP | 4.40 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|