C43H54N6O2S2 — CID 174902133
10-[3-(dimethylamino)-2-methylpropyl]phenothiazine-2-carbonitrile;2-[2-[4-(2-methyl-3-phenothiazin-10-ylpropyl)piperazin-1-yl]ethoxy]ethanol (PubChem CID 174902133) has the molecular formula C43H54N6O2S2 and a molecular weight of 751.08 g/mol. Its IUPAC name is 10-[3-(dimethylamino)-2-methylpropyl]phenothiazine-2-carbonitrile;2-[2-[4-(2-methyl-3-phenothiazin-10-ylpropyl)piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 10-[3-(dimethylamino)-2-methylpropyl]phenothiazine-2-carbonitrile;2-[2-[4-(2-methyl-3-phenothiazin-10-ylpropyl)piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 174902133 |
| Molecular Formula | C43H54N6O2S2 |
| Molecular Weight | 751.08 g/mol |
| Exact Mass | 750.37 |
| IUPAC Name | 10-[3-(dimethylamino)-2-methylpropyl]phenothiazine-2-carbonitrile;2-[2-[4-(2-methyl-3-phenothiazin-10-ylpropyl)piperazin-1-yl]ethoxy]ethanol |
| SMILES | CC(CN(C)C)CN1c2ccccc2Sc2ccc(C#N)cc21.CC(CN1CCN(CCOCCO)CC1)CN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C24H33N3O2S.C19H21N3S/c1-20(18-26-12-10-25(11-13-26)14-16-29-17-15-28)19-27-21-6-2-4-8-23(21)30-24-9-5-3-7-22(24)27;1-14(12-21(2)3)13-22-16-6-4-5-7-18(16)23-19-9-8-15(11-20)10-17(19)22/h2-9,20,28H,10-19H2,1H3;4-10,14H,12-13H2,1-3H3 |
| InChIKey | XPZCFCWOQGNUBK-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.08 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|