C12H24N2O — CID 103069971
2-[cyclopropyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol (PubChem CID 103069971) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol.
| Compound Name | 2-[cyclopropyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol |
|---|---|
| PubChem CID | 103069971 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-[cyclopropyl-[2-[(propan-2-ylamino)methyl]prop-2-enyl]amino]ethanol |
| SMILES | C=C(CNC(C)C)CN(CCO)C1CC1 |
| InChI | InChI=1S/C12H24N2O/c1-10(2)13-8-11(3)9-14(6-7-15)12-4-5-12/h10,12-13,15H,3-9H2,1-2H3 |
| InChIKey | ZYQOHEVUBHRSIL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|