C14H22N2 — CID 103070244
N'-(2,4-dimethylphenyl)-N,N'-dimethyl-2-methylidenepropane-1,3-diamine (PubChem CID 103070244) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-(2,4-dimethylphenyl)-N,N'-dimethyl-2-methylidenepropane-1,3-diamine.
| Compound Name | N'-(2,4-dimethylphenyl)-N,N'-dimethyl-2-methylidenepropane-1,3-diamine |
|---|---|
| PubChem CID | 103070244 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-(2,4-dimethylphenyl)-N,N'-dimethyl-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNC)CN(C)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H22N2/c1-11-6-7-14(13(3)8-11)16(5)10-12(2)9-15-4/h6-8,15H,2,9-10H2,1,3-5H3 |
| InChIKey | UPEXKMYWGPGGSP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|