C16H20N2O2S — CID 103072944
3-[2-[(tert-butylamino)methyl]prop-2-enyl]-1,3-benzothiazine-2,4-dione (PubChem CID 103072944) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-[2-[(tert-butylamino)methyl]prop-2-enyl]-1,3-benzothiazine-2,4-dione.
| Compound Name | 3-[2-[(tert-butylamino)methyl]prop-2-enyl]-1,3-benzothiazine-2,4-dione |
|---|---|
| PubChem CID | 103072944 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-[2-[(tert-butylamino)methyl]prop-2-enyl]-1,3-benzothiazine-2,4-dione |
| SMILES | C=C(CNC(C)(C)C)Cn1c(=O)sc2ccccc2c1=O |
| InChI | InChI=1S/C16H20N2O2S/c1-11(9-17-16(2,3)4)10-18-14(19)12-7-5-6-8-13(12)21-15(18)20/h5-8,17H,1,9-10H2,2-4H3 |
| InChIKey | QFMNUPVXXVFNKZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|