C21H15Cl2FN2 — CID 10309456
4,5-bis(4-chlorophenyl)-2-(3-fluorophenyl)-4,5-dihydro-1H-imidazole (PubChem CID 10309456) has the molecular formula C21H15Cl2FN2 and a molecular weight of 385.27 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-2-(3-fluorophenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 4,5-bis(4-chlorophenyl)-2-(3-fluorophenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 10309456 |
| Molecular Formula | C21H15Cl2FN2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-2-(3-fluorophenyl)-4,5-dihydro-1H-imidazole |
| SMILES | Fc1cccc(C2=NC(c3ccc(Cl)cc3)C(c3ccc(Cl)cc3)N2)c1 |
| InChI | InChI=1S/C21H15Cl2FN2/c22-16-8-4-13(5-9-16)19-20(14-6-10-17(23)11-7-14)26-21(25-19)15-2-1-3-18(24)12-15/h1-12,19-20H,(H,25,26) |
| InChIKey | LOSZETUJMHMDBD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |