C10H12F2N2O3S — CID 103097841
N-(2,6-difluoro-3-pyridinyl)-2-methyl-2-methylsulfonylpropanamide (PubChem CID 103097841) has the molecular formula C10H12F2N2O3S and a molecular weight of 278.28 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 103097841 |
| Molecular Formula | C10H12F2N2O3S |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(F)nc1F)S(C)(=O)=O |
| InChI | InChI=1S/C10H12F2N2O3S/c1-10(2,18(3,16)17)9(15)13-6-4-5-7(11)14-8(6)12/h4-5H,1-3H3,(H,13,15) |
| InChIKey | CZLFESTXVYAWNN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|