C26H35NO4S — CID 10310612
2-[[5-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]sulfinylphenyl]methylideneamino]propanoic acid (PubChem CID 10310612) has the molecular formula C26H35NO4S and a molecular weight of 457.64 g/mol. Its IUPAC name is 2-[[5-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]sulfinylphenyl]methylideneamino]propanoic acid.
| Compound Name | 2-[[5-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]sulfinylphenyl]methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 10310612 |
| Molecular Formula | C26H35NO4S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-[[5-methoxy-2-[2,4,6-tri(propan-2-yl)phenyl]sulfinylphenyl]methylideneamino]propanoic acid |
| SMILES | COc1ccc(S(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(/C=N\C(C)C(=O)O)c1 |
| InChI | InChI=1S/C26H35NO4S/c1-15(2)19-12-22(16(3)4)25(23(13-19)17(5)6)32(30)24-10-9-21(31-8)11-20(24)14-27-18(7)26(28)29/h9-18H,1-8H3,(H,28,29)/b27-14- |
| InChIKey | FJPKUPJMLHMVLH-VYYCAZPPSA-N |
| XLogP | 6.12 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|