C20H32O4 — CID 10314975
(4aS,6R,8aR)-4a-hydroperoxy-4,8a-dimethyl-6-(6-methyl-4-oxoheptan-2-yl)-5,6,7,8-tetrahydro-1H-naphthalen-2-one (PubChem CID 10314975) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (4aS,6R,8aR)-4a-hydroperoxy-4,8a-dimethyl-6-(6-methyl-4-oxoheptan-2-yl)-5,6,7,8-tetrahydro-1H-naphthalen-2-one.
| Compound Name | (4aS,6R,8aR)-4a-hydroperoxy-4,8a-dimethyl-6-(6-methyl-4-oxoheptan-2-yl)-5,6,7,8-tetrahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 10314975 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (4aS,6R,8aR)-4a-hydroperoxy-4,8a-dimethyl-6-(6-methyl-4-oxoheptan-2-yl)-5,6,7,8-tetrahydro-1H-naphthalen-2-one |
| SMILES | CC1=CC(=O)C[C@@]2(C)CC[C@@H](C(C)CC(=O)CC(C)C)C[C@@]12OO |
| InChI | InChI=1S/C20H32O4/c1-13(2)8-17(21)9-14(3)16-6-7-19(5)12-18(22)10-15(4)20(19,11-16)24-23/h10,13-14,16,23H,6-9,11-12H2,1-5H3/t14?,16-,19-,20-/m1/s1 |
| InChIKey | NSYIWDWDFMSPJJ-VWZLZXLISA-N |
| XLogP | 4.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|