C14H18N2O6S — CID 10315326
(2S)-2-amino-4-[[4-(carboxymethylcarbamoyl)phenyl]methylsulfinyl]butanoic acid (PubChem CID 10315326) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is (2S)-2-amino-4-[[4-(carboxymethylcarbamoyl)phenyl]methylsulfinyl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[4-(carboxymethylcarbamoyl)phenyl]methylsulfinyl]butanoic acid |
|---|---|
| PubChem CID | 10315326 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2S)-2-amino-4-[[4-(carboxymethylcarbamoyl)phenyl]methylsulfinyl]butanoic acid |
| SMILES | N[C@@H](CCS(=O)Cc1ccc(C(=O)NCC(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C14H18N2O6S/c15-11(14(20)21)5-6-23(22)8-9-1-3-10(4-2-9)13(19)16-7-12(17)18/h1-4,11H,5-8,15H2,(H,16,19)(H,17,18)(H,20,21)/t11-,23?/m0/s1 |
| InChIKey | DDRQSSRKJKZZLT-OLECLEPYSA-N |
| XLogP | -0.45 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |