C24H12N4 — CID 10316223
(11-cyanoimino-6-hexacyclo[14.4.2.05,20.07,19.010,18.012,17]docosa-1(20),2,4,7(19),8,10(18),12,14,16-nonaenylidene)cyanamide (PubChem CID 10316223) has the molecular formula C24H12N4 and a molecular weight of 356.39 g/mol. Its IUPAC name is (11-cyanoimino-6-hexacyclo[14.4.2.05,20.07,19.010,18.012,17]docosa-1(20),2,4,7(19),8,10(18),12,14,16-nonaenylidene)cyanamide.
| Compound Name | (11-cyanoimino-6-hexacyclo[14.4.2.05,20.07,19.010,18.012,17]docosa-1(20),2,4,7(19),8,10(18),12,14,16-nonaenylidene)cyanamide |
|---|---|
| PubChem CID | 10316223 |
| Molecular Formula | C24H12N4 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (11-cyanoimino-6-hexacyclo[14.4.2.05,20.07,19.010,18.012,17]docosa-1(20),2,4,7(19),8,10(18),12,14,16-nonaenylidene)cyanamide |
| SMILES | N#C/N=c1\c2cccc3c2c2c1ccc1/c(=N/C#N)c4cccc(c4c12)CC3 |
| InChI | InChI=1S/C24H12N4/c25-11-27-23-15-5-1-3-13-7-8-14-4-2-6-16-20(14)22-18(24(16)28-12-26)10-9-17(23)21(22)19(13)15/h1-6,9-10H,7-8H2/b27-23+,28-24+ |
| InChIKey | HODLOPRSJHROHE-LMCGJEQXSA-N |
| XLogP | 4.04 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|