About [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate
[2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate (PubChem CID 10317013) has the molecular formula C19H32NO4P
and a molecular weight of 369.44 g/mol. Its IUPAC name is [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate.
Molecular Properties
| Compound Name | [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate |
| PubChem CID | 10317013 |
| Molecular Formula | C19H32NO4P |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate |
| SMILES | C=CCN(C)C(C)C(OP(=O)(OC(C)C)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H32NO4P/c1-8-14-20(7)17(6)19(18-12-10-9-11-13-18)24-25(21,22-15(2)3)23-16(4)5/h8-13,15-17,19H,1,14H2,2-7H3 |
| InChIKey | FMEMWWHCCSYIDV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate?
The IUPAC name of [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate (CID 10317013) is [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate.
What is the SMILES notation for [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate?
The canonical SMILES for [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate is C=CCN(C)C(C)C(OP(=O)(OC(C)C)OC(C)C)c1ccccc1.
What is the InChIKey of [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate?
The InChIKey is FMEMWWHCCSYIDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32NO4P/c1-8-14-20(7)17(6)19(18-12-10-9-11-13-18)24-25(21,22-15(2)3)23-16(4)5/h8-13,15-17,19H,1,14H2,2-7H3.
What are the key properties of [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate?
[2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate has a molecular weight of 369.44 g/mol, XLogP of 5.21, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[methyl(prop-2-enyl)amino]-1-phenylpropyl] dipropan-2-yl phosphate is sourced from PubChem (CID 10317013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).