C12H19NO3S — CID 103173570
3-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]butan-1-ol (PubChem CID 103173570) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 3-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]butan-1-ol.
| Compound Name | 3-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 103173570 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[(3,4-dimethoxy-2-pyridinyl)methylsulfanyl]butan-1-ol |
| SMILES | COc1ccnc(CSC(C)CCO)c1OC |
| InChI | InChI=1S/C12H19NO3S/c1-9(5-7-14)17-8-10-12(16-3)11(15-2)4-6-13-10/h4,6,9,14H,5,7-8H2,1-3H3 |
| InChIKey | VFPLCFWBWQCMAS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |