C22H30O2SSi — CID 10318011
methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanoate (PubChem CID 10318011) has the molecular formula C22H30O2SSi and a molecular weight of 386.63 g/mol. Its IUPAC name is methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanoate.
| Compound Name | methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanoate |
|---|---|
| PubChem CID | 10318011 |
| Molecular Formula | C22H30O2SSi |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanoate |
| SMILES | COC(=O)[C@H](Sc1ccccc1)[C@@H](CC(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H30O2SSi/c1-17(2)16-20(26(4,5)19-14-10-7-11-15-19)21(22(23)24-3)25-18-12-8-6-9-13-18/h6-15,17,20-21H,16H2,1-5H3/t20-,21-/m1/s1 |
| InChIKey | DDIPGDLVFRXJBA-NHCUHLMSSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|