C14H22N2O2 — CID 103180351
1-[2-(3-methoxypropoxy)ethyl]-2,3-dihydroindol-6-amine (PubChem CID 103180351) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[2-(3-methoxypropoxy)ethyl]-2,3-dihydroindol-6-amine.
| Compound Name | 1-[2-(3-methoxypropoxy)ethyl]-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 103180351 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[2-(3-methoxypropoxy)ethyl]-2,3-dihydroindol-6-amine |
| SMILES | COCCCOCCN1CCc2ccc(N)cc21 |
| InChI | InChI=1S/C14H22N2O2/c1-17-8-2-9-18-10-7-16-6-5-12-3-4-13(15)11-14(12)16/h3-4,11H,2,5-10,15H2,1H3 |
| InChIKey | QIDMCWMTGHGBCA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|