C18H22N2O3 — CID 39456546
1-[2-(3,5-dimethoxyphenoxy)ethyl]-2,3-dihydroindol-6-amine (PubChem CID 39456546) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyphenoxy)ethyl]-2,3-dihydroindol-6-amine.
| Compound Name | 1-[2-(3,5-dimethoxyphenoxy)ethyl]-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 39456546 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-[2-(3,5-dimethoxyphenoxy)ethyl]-2,3-dihydroindol-6-amine |
| SMILES | COc1cc(OC)cc(OCCN2CCc3ccc(N)cc32)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-21-15-10-16(22-2)12-17(11-15)23-8-7-20-6-5-13-3-4-14(19)9-18(13)20/h3-4,9-12H,5-8,19H2,1-2H3 |
| InChIKey | YUIVDXKEHDGYRI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|