C19H24N2O — CID 39415427
1-[2-(2,3,6-trimethylphenoxy)ethyl]-2,3-dihydroindol-6-amine (PubChem CID 39415427) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-[2-(2,3,6-trimethylphenoxy)ethyl]-2,3-dihydroindol-6-amine.
| Compound Name | 1-[2-(2,3,6-trimethylphenoxy)ethyl]-2,3-dihydroindol-6-amine |
|---|---|
| PubChem CID | 39415427 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-[2-(2,3,6-trimethylphenoxy)ethyl]-2,3-dihydroindol-6-amine |
| SMILES | Cc1ccc(C)c(OCCN2CCc3ccc(N)cc32)c1C |
| InChI | InChI=1S/C19H24N2O/c1-13-4-5-14(2)19(15(13)3)22-11-10-21-9-8-16-6-7-17(20)12-18(16)21/h4-7,12H,8-11,20H2,1-3H3 |
| InChIKey | YZTMZAWZCHFIJR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|