C10H8N4O — CID 103205059
2-(1,2,4-benzotriazin-3-yl)-3-hydroxypropanenitrile (PubChem CID 103205059) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-(1,2,4-benzotriazin-3-yl)-3-hydroxypropanenitrile.
| Compound Name | 2-(1,2,4-benzotriazin-3-yl)-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 103205059 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(1,2,4-benzotriazin-3-yl)-3-hydroxypropanenitrile |
| SMILES | N#CC(CO)c1nnc2ccccc2n1 |
| InChI | InChI=1S/C10H8N4O/c11-5-7(6-15)10-12-8-3-1-2-4-9(8)13-14-10/h1-4,7,15H,6H2 |
| InChIKey | AKPBYHLEVCBOID-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |