C12H20F2N2O2 — CID 103213190
N-[1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethyl]propan-1-amine (PubChem CID 103213190) has the molecular formula C12H20F2N2O2 and a molecular weight of 262.30 g/mol. Its IUPAC name is N-[1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103213190 |
| Molecular Formula | C12H20F2N2O2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[1-[5-[2-(2,2-difluoroethoxy)ethyl]-1,3-oxazol-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ncc(CCOCC(F)F)o1 |
| InChI | InChI=1S/C12H20F2N2O2/c1-3-5-15-9(2)12-16-7-10(18-12)4-6-17-8-11(13)14/h7,9,11,15H,3-6,8H2,1-2H3 |
| InChIKey | UNRVKOARBFARJX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|