C28H18F6 — CID 10322373
1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-phenylphenyl)cyclobutyl]-4-phenylbenzene (PubChem CID 10322373) has the molecular formula C28H18F6 and a molecular weight of 468.44 g/mol. Its IUPAC name is 1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-phenylphenyl)cyclobutyl]-4-phenylbenzene.
| Compound Name | 1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-phenylphenyl)cyclobutyl]-4-phenylbenzene |
|---|---|
| PubChem CID | 10322373 |
| Molecular Formula | C28H18F6 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 1-[(1R,4R)-1,2,2,3,3,4-hexafluoro-4-(4-phenylphenyl)cyclobutyl]-4-phenylbenzene |
| SMILES | FC1(F)C(F)(F)[C@@](F)(c2ccc(-c3ccccc3)cc2)[C@]1(F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H18F6/c29-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)26(30,28(33,34)27(25,31)32)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H/t25-,26-/m1/s1 |
| InChIKey | QJBJRQFUGLAXAZ-CLJLJLNGSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|