C24H22N8O4 — CID 10323127
phenyl N-[[4-(4-methoxy-2-methylphenyl)-6-[2-(pyridine-4-carbonyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]carbamate (PubChem CID 10323127) has the molecular formula C24H22N8O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is phenyl N-[[4-(4-methoxy-2-methylphenyl)-6-[2-(pyridine-4-carbonyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]carbamate.
| Compound Name | phenyl N-[[4-(4-methoxy-2-methylphenyl)-6-[2-(pyridine-4-carbonyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 10323127 |
| Molecular Formula | C24H22N8O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | phenyl N-[[4-(4-methoxy-2-methylphenyl)-6-[2-(pyridine-4-carbonyl)hydrazinyl]-1,3,5-triazin-2-yl]amino]carbamate |
| SMILES | COc1ccc(-c2nc(NNC(=O)Oc3ccccc3)nc(NNC(=O)c3ccncc3)n2)c(C)c1 |
| InChI | InChI=1S/C24H22N8O4/c1-15-14-18(35-2)8-9-19(15)20-26-22(30-29-21(33)16-10-12-25-13-11-16)28-23(27-20)31-32-24(34)36-17-6-4-3-5-7-17/h3-14H,1-2H3,(H,29,33)(H,32,34)(H2,26,27,28,30,31) |
| InChIKey | HCRILKMMDHEBBU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 152.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|