C9H15NO4S — CID 103239273
methyl (E)-3-[(1,1-dioxothian-4-yl)amino]prop-2-enoate (PubChem CID 103239273) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is methyl (E)-3-[(1,1-dioxothian-4-yl)amino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1,1-dioxothian-4-yl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 103239273 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methyl (E)-3-[(1,1-dioxothian-4-yl)amino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H15NO4S/c1-14-9(11)2-5-10-8-3-6-15(12,13)7-4-8/h2,5,8,10H,3-4,6-7H2,1H3/b5-2+ |
| InChIKey | KBDHZBFEFKQEBO-GORDUTHDSA-N |
| XLogP | -0.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|