C22H12ClF5NS2+ — CID 10325580
5-(4-chlorophenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-3-phenyl-1,3-thiazol-3-ium (PubChem CID 10325580) has the molecular formula C22H12ClF5NS2+ and a molecular weight of 484.92 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-3-phenyl-1,3-thiazol-3-ium.
| Compound Name | 5-(4-chlorophenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-3-phenyl-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 10325580 |
| Molecular Formula | C22H12ClF5NS2+ |
| Molecular Weight | 484.92 g/mol |
| Exact Mass | 484.00 |
| IUPAC Name | 5-(4-chlorophenyl)-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-3-phenyl-1,3-thiazol-3-ium |
| SMILES | Fc1c(F)c(F)c(CSc2c(-c3ccc(Cl)cc3)sc[n+]2-c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C22H12ClF5NS2/c23-13-8-6-12(7-9-13)21-22(29(11-31-21)14-4-2-1-3-5-14)30-10-15-16(24)18(26)20(28)19(27)17(15)25/h1-9,11H,10H2/q+1 |
| InChIKey | ADOHFUCCDFFGBR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.92 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|