C17H30N2 — CID 103276324
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 103276324) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 103276324 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | CC1=CC(C)CC(CNC2CCN3CCCCC23)C1 |
| InChI | InChI=1S/C17H30N2/c1-13-9-14(2)11-15(10-13)12-18-16-6-8-19-7-4-3-5-17(16)19/h9,13,15-18H,3-8,10-12H2,1-2H3 |
| InChIKey | YPLBKEKKVCZBIT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|