C19H34N2 — CID 123216341
2-butyl-5-(2-methylcyclohept-3-en-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine (PubChem CID 123216341) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 2-butyl-5-(2-methylcyclohept-3-en-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine.
| Compound Name | 2-butyl-5-(2-methylcyclohept-3-en-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 123216341 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 2-butyl-5-(2-methylcyclohept-3-en-1-yl)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
| SMILES | CCCCC1CC2CN(C3CCCC=CC3C)CCC2N1 |
| InChI | InChI=1S/C19H34N2/c1-3-4-9-17-13-16-14-21(12-11-18(16)20-17)19-10-7-5-6-8-15(19)2/h6,8,15-20H,3-5,7,9-14H2,1-2H3 |
| InChIKey | VIMJCBPYZIAVNW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|