C14H25NS2 — CID 103277104
1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1,4-dithian-2-ylmethyl)methanamine (PubChem CID 103277104) has the molecular formula C14H25NS2 and a molecular weight of 271.50 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1,4-dithian-2-ylmethyl)methanamine.
| Compound Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1,4-dithian-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 103277104 |
| Molecular Formula | C14H25NS2 |
| Molecular Weight | 271.50 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-(3,5-dimethylcyclohex-3-en-1-yl)-N-(1,4-dithian-2-ylmethyl)methanamine |
| SMILES | CC1=CC(C)CC(CNCC2CSCCS2)C1 |
| InChI | InChI=1S/C14H25NS2/c1-11-5-12(2)7-13(6-11)8-15-9-14-10-16-3-4-17-14/h5,11,13-15H,3-4,6-10H2,1-2H3 |
| InChIKey | HFKZHKKKUCCBCH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|