C15H25NS2 — CID 123496182
6-[(2,6-dimethylcyclohexen-1-yl)sulfanylmethyl]piperidine-2-carbothialdehyde (PubChem CID 123496182) has the molecular formula C15H25NS2 and a molecular weight of 283.51 g/mol. Its IUPAC name is 6-[(2,6-dimethylcyclohexen-1-yl)sulfanylmethyl]piperidine-2-carbothialdehyde.
| Compound Name | 6-[(2,6-dimethylcyclohexen-1-yl)sulfanylmethyl]piperidine-2-carbothialdehyde |
|---|---|
| PubChem CID | 123496182 |
| Molecular Formula | C15H25NS2 |
| Molecular Weight | 283.51 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 6-[(2,6-dimethylcyclohexen-1-yl)sulfanylmethyl]piperidine-2-carbothialdehyde |
| SMILES | CC1=C(SCC2CCCC(C=S)N2)C(C)CCC1 |
| InChI | InChI=1S/C15H25NS2/c1-11-5-3-6-12(2)15(11)18-10-14-8-4-7-13(9-17)16-14/h9,11,13-14,16H,3-8,10H2,1-2H3 |
| InChIKey | SJQSIQOYMKYBLY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|