C15H29NS — CID 103277134
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-ethylsulfanylbutan-2-amine (PubChem CID 103277134) has the molecular formula C15H29NS and a molecular weight of 255.47 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-ethylsulfanylbutan-2-amine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-ethylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 103277134 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-4-ethylsulfanylbutan-2-amine |
| SMILES | CCSCCC(C)NCC1CC(C)=CC(C)C1 |
| InChI | InChI=1S/C15H29NS/c1-5-17-7-6-14(4)16-11-15-9-12(2)8-13(3)10-15/h8,12,14-16H,5-7,9-11H2,1-4H3 |
| InChIKey | JYOXMVRROIFBFI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|